C11H14N2O2 — CID 123825903
(1S,3R)-3-amino-1-(2-isocyanophenyl)butane-1,4-diol (PubChem CID 123825903) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is (1S,3R)-3-amino-1-(2-isocyanophenyl)butane-1,4-diol.
| Compound Name | (1S,3R)-3-amino-1-(2-isocyanophenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 123825903 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (1S,3R)-3-amino-1-(2-isocyanophenyl)butane-1,4-diol |
| SMILES | [C-]#[N+]c1ccccc1[C@@H](O)C[C@@H](N)CO |
| InChI | InChI=1S/C11H14N2O2/c1-13-10-5-3-2-4-9(10)11(15)6-8(12)7-14/h2-5,8,11,14-15H,6-7,12H2/t8-,11+/m1/s1 |
| InChIKey | JAYCTIMYKXYQTP-KCJUWKMLSA-N |
| XLogP | 0.98 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|