C15H32O2 — CID 123833206
4-hydroperoxy-2,2,3-trimethyl-3-propan-2-ylnonane (PubChem CID 123833206) has the molecular formula C15H32O2 and a molecular weight of 244.42 g/mol. Its IUPAC name is 4-hydroperoxy-2,2,3-trimethyl-3-propan-2-ylnonane.
| Compound Name | 4-hydroperoxy-2,2,3-trimethyl-3-propan-2-ylnonane |
|---|---|
| PubChem CID | 123833206 |
| Molecular Formula | C15H32O2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.24 |
| IUPAC Name | 4-hydroperoxy-2,2,3-trimethyl-3-propan-2-ylnonane |
| SMILES | CCCCCC(OO)C(C)(C(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H32O2/c1-8-9-10-11-13(17-16)15(7,12(2)3)14(4,5)6/h12-13,16H,8-11H2,1-7H3 |
| InChIKey | KKGCHOPCLMXFKD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|