C21H24N4O3S — CID 123846113
3-[2-(4-aminophenyl)ethylamino]-2-(2-amino-1,3-thiazol-4-yl)-4-hydroxy-4-phenylbutanoic acid (PubChem CID 123846113) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 3-[2-(4-aminophenyl)ethylamino]-2-(2-amino-1,3-thiazol-4-yl)-4-hydroxy-4-phenylbutanoic acid.
| Compound Name | 3-[2-(4-aminophenyl)ethylamino]-2-(2-amino-1,3-thiazol-4-yl)-4-hydroxy-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 123846113 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 3-[2-(4-aminophenyl)ethylamino]-2-(2-amino-1,3-thiazol-4-yl)-4-hydroxy-4-phenylbutanoic acid |
| SMILES | Nc1ccc(CCNC(C(O)c2ccccc2)C(C(=O)O)c2csc(N)n2)cc1 |
| InChI | InChI=1S/C21H24N4O3S/c22-15-8-6-13(7-9-15)10-11-24-18(19(26)14-4-2-1-3-5-14)17(20(27)28)16-12-29-21(23)25-16/h1-9,12,17-19,24,26H,10-11,22H2,(H2,23,25)(H,27,28) |
| InChIKey | HWUPDVULDULKTP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|