C21H24ClN5O3S — CID 175678791
2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-N-nitrosoacetamide;hydrochloride (PubChem CID 175678791) has the molecular formula C21H24ClN5O3S and a molecular weight of 461.98 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-N-nitrosoacetamide;hydrochloride.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-N-nitrosoacetamide;hydrochloride |
|---|---|
| PubChem CID | 175678791 |
| Molecular Formula | C21H24ClN5O3S |
| Molecular Weight | 461.98 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-N-nitrosoacetamide;hydrochloride |
| SMILES | Cl.Nc1nc(CC(=O)N(N=O)c2ccc(CCNCC(O)c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C21H23N5O3S.ClH/c22-21-24-17(14-30-21)12-20(28)26(25-29)18-8-6-15(7-9-18)10-11-23-13-19(27)16-4-2-1-3-5-16;/h1-9,14,19,23,27H,10-13H2,(H2,22,24);1H |
| InChIKey | ZFFZJHJNUVXSSA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.98 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|