C27H31N5O — CID 123855928
7-ethyl-2-(2-hexa-1,3-dien-2-yl-4-methyl-4H-pyridin-1-yl)-5-methyl-8-phenyl-7H-pteridin-6-one (PubChem CID 123855928) has the molecular formula C27H31N5O and a molecular weight of 441.58 g/mol. Its IUPAC name is 7-ethyl-2-(2-hexa-1,3-dien-2-yl-4-methyl-4H-pyridin-1-yl)-5-methyl-8-phenyl-7H-pteridin-6-one.
| Compound Name | 7-ethyl-2-(2-hexa-1,3-dien-2-yl-4-methyl-4H-pyridin-1-yl)-5-methyl-8-phenyl-7H-pteridin-6-one |
|---|---|
| PubChem CID | 123855928 |
| Molecular Formula | C27H31N5O |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 7-ethyl-2-(2-hexa-1,3-dien-2-yl-4-methyl-4H-pyridin-1-yl)-5-methyl-8-phenyl-7H-pteridin-6-one |
| SMILES | C=C(C=CCC)C1=CC(C)C=CN1c1ncc2c(n1)N(c1ccccc1)C(CC)C(=O)N2C |
| InChI | InChI=1S/C27H31N5O/c1-6-8-12-20(4)23-17-19(3)15-16-31(23)27-28-18-24-25(29-27)32(21-13-10-9-11-14-21)22(7-2)26(33)30(24)5/h8-19,22H,4,6-7H2,1-3,5H3 |
| InChIKey | XQHWBYLPUIUIPT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|