C21H22N4O6 — CID 123866820
tert-butyl N-[amino-[4-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]-2-pyridinyl]methylidene]carbamate (PubChem CID 123866820) has the molecular formula C21H22N4O6 and a molecular weight of 426.43 g/mol. Its IUPAC name is tert-butyl N-[amino-[4-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]-2-pyridinyl]methylidene]carbamate.
| Compound Name | tert-butyl N-[amino-[4-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]-2-pyridinyl]methylidene]carbamate |
|---|---|
| PubChem CID | 123866820 |
| Molecular Formula | C21H22N4O6 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | tert-butyl N-[amino-[4-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]-2-pyridinyl]methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=C(N)c1cc(OCCON2C(=O)c3ccccc3C2=O)ccn1 |
| InChI | InChI=1S/C21H22N4O6/c1-21(2,3)31-20(28)24-17(22)16-12-13(8-9-23-16)29-10-11-30-25-18(26)14-6-4-5-7-15(14)19(25)27/h4-9,12H,10-11H2,1-3H3,(H2,22,24,28) |
| InChIKey | BNNGRZWEVIHZKU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|