C57H52N6OSi2 — CID 123879899
[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-dimethyl-7-trimethylsilylxanthen-2-yl]-trimethylsilane (PubChem CID 123879899) has the molecular formula C57H52N6OSi2 and a molecular weight of 893.26 g/mol. Its IUPAC name is [4-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-dimethyl-7-trimethylsilylxanthen-2-yl]-trimethylsilane.
| Compound Name | [4-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-dimethyl-7-trimethylsilylxanthen-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 123879899 |
| Molecular Formula | C57H52N6OSi2 |
| Molecular Weight | 893.26 g/mol |
| Exact Mass | 892.37 |
| IUPAC Name | [4-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-dimethyl-7-trimethylsilylxanthen-2-yl]-trimethylsilane |
| SMILES | CC1(C)c2cc([Si](C)(C)C)cc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)c2Oc2c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc([Si](C)(C)C)cc21 |
| InChI | InChI=1S/C57H52N6OSi2/c1-57(2)47-35-43(65(3,4)5)33-45(41-30-21-31-42(32-41)55-60-51(37-22-13-9-14-23-37)58-52(61-55)38-24-15-10-16-25-38)49(47)64-50-46(34-44(36-48(50)57)66(6,7)8)56-62-53(39-26-17-11-18-27-39)59-54(63-56)40-28-19-12-20-29-40/h9-36H,1-8H3 |
| InChIKey | CZZUQXPIFRALAV-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 86.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.26 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|