C11H17N — CID 123881746
4,7-diethylcyclohepta-2,4-dien-1-imine (PubChem CID 123881746) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 4,7-diethylcyclohepta-2,4-dien-1-imine.
| Compound Name | 4,7-diethylcyclohepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123881746 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 4,7-diethylcyclohepta-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC(CC)=CCC1CC |
| InChI | InChI=1S/C11H17N/c1-3-9-5-7-10(4-2)11(12)8-6-9/h5-6,8,10,12H,3-4,7H2,1-2H3/b12-11+ |
| InChIKey | IEHRIVFMHMXBCD-VAWYXSNFSA-N |
| XLogP | 3.33 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|