C22H30F4N4 — CID 123882235
(E)-[(9Z)-1-fluoro-7,12-dimethyl-9-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)-6,7,11,12-tetrahydro-5H-benzo[10]annulen-8-ylidene]hydrazine (PubChem CID 123882235) has the molecular formula C22H30F4N4 and a molecular weight of 426.50 g/mol. Its IUPAC name is (E)-[(9Z)-1-fluoro-7,12-dimethyl-9-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)-6,7,11,12-tetrahydro-5H-benzo[10]annulen-8-ylidene]hydrazine.
| Compound Name | (E)-[(9Z)-1-fluoro-7,12-dimethyl-9-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)-6,7,11,12-tetrahydro-5H-benzo[10]annulen-8-ylidene]hydrazine |
|---|---|
| PubChem CID | 123882235 |
| Molecular Formula | C22H30F4N4 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (E)-[(9Z)-1-fluoro-7,12-dimethyl-9-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)-6,7,11,12-tetrahydro-5H-benzo[10]annulen-8-ylidene]hydrazine |
| SMILES | CC1CCc2cc(C(F)(F)F)cc(F)c2C(C)C/C=C(N2CCN(C)CC2)/C1=N/N |
| InChI | InChI=1S/C22H30F4N4/c1-14-5-7-19(30-10-8-29(3)9-11-30)21(28-27)15(2)4-6-16-12-17(22(24,25)26)13-18(23)20(14)16/h7,12-15H,4-6,8-11,27H2,1-3H3/b19-7-,28-21+ |
| InChIKey | QCSVZIVTAOOVDN-QBKCWYSQSA-N |
| XLogP | 4.37 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|