C21H27F3N5+ — CID 123887023
4,10,12-trimethyl-7-(4-methylpiperazin-1-yl)-14-(trifluoromethyl)-4,5-diaza-2-azoniatricyclo[9.4.0.02,6]pentadeca-1(11),2,5,7,12,14-hexaene (PubChem CID 123887023) has the molecular formula C21H27F3N5+ and a molecular weight of 406.48 g/mol. Its IUPAC name is 4,10,12-trimethyl-7-(4-methylpiperazin-1-yl)-14-(trifluoromethyl)-4,5-diaza-2-azoniatricyclo[9.4.0.02,6]pentadeca-1(11),2,5,7,12,14-hexaene.
| Compound Name | 4,10,12-trimethyl-7-(4-methylpiperazin-1-yl)-14-(trifluoromethyl)-4,5-diaza-2-azoniatricyclo[9.4.0.02,6]pentadeca-1(11),2,5,7,12,14-hexaene |
|---|---|
| PubChem CID | 123887023 |
| Molecular Formula | C21H27F3N5+ |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 4,10,12-trimethyl-7-(4-methylpiperazin-1-yl)-14-(trifluoromethyl)-4,5-diaza-2-azoniatricyclo[9.4.0.02,6]pentadeca-1(11),2,5,7,12,14-hexaene |
| SMILES | Cc1cc(C(F)(F)F)cc2c1C(C)CC=C(N1CCN(C)CC1)c1nn(C)c[n+]1-2 |
| InChI | InChI=1S/C21H27F3N5/c1-14-5-6-17(28-9-7-26(3)8-10-28)20-25-27(4)13-29(20)18-12-16(21(22,23)24)11-15(2)19(14)18/h6,11-14H,5,7-10H2,1-4H3/q+1 |
| InChIKey | CDPHQTUSHXNDGB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|