C25H40B2NO4 — CID 123886425
CID 123886425 (PubChem CID 123886425) has the molecular formula C25H40B2NO4 and a molecular weight of 440.22 g/mol.
| Compound Name | CID 123886425 |
|---|---|
| PubChem CID | 123886425 |
| Molecular Formula | C25H40B2NO4 |
| Molecular Weight | 440.22 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | — |
| SMILES | CN1CCCC12CCc1c([B]OC(C)(C)C(C)(C)O)ccc(B3OC(C)(C)C(C)(C)O3)c12 |
| InChI | InChI=1S/C25H40B2NO4/c1-21(2,29)22(3,4)30-26-18-11-12-19(27-31-23(5,6)24(7,8)32-27)20-17(18)13-15-25(20)14-10-16-28(25)9/h11-12,29H,10,13-16H2,1-9H3 |
| InChIKey | JAWOGJPVHGRHSQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|