C14H16ClN3O4S — CID 123907571
4-chloro-N-ethyl-2-(furan-2-ylmethylamino)-N-sulfamoylbenzamide (PubChem CID 123907571) has the molecular formula C14H16ClN3O4S and a molecular weight of 357.82 g/mol. Its IUPAC name is 4-chloro-N-ethyl-2-(furan-2-ylmethylamino)-N-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-ethyl-2-(furan-2-ylmethylamino)-N-sulfamoylbenzamide |
|---|---|
| PubChem CID | 123907571 |
| Molecular Formula | C14H16ClN3O4S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 4-chloro-N-ethyl-2-(furan-2-ylmethylamino)-N-sulfamoylbenzamide |
| SMILES | CCN(C(=O)c1ccc(Cl)cc1NCc1ccco1)S(N)(=O)=O |
| InChI | InChI=1S/C14H16ClN3O4S/c1-2-18(23(16,20)21)14(19)12-6-5-10(15)8-13(12)17-9-11-4-3-7-22-11/h3-8,17H,2,9H2,1H3,(H2,16,20,21) |
| InChIKey | YIBNMCUKSKJNBM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |