C19H18 — CID 123914299
pentacyclo[10.7.0.01,4.05,10.013,18]nonadeca-5,7,9,13,15,17-hexaene (PubChem CID 123914299) has the molecular formula C19H18 and a molecular weight of 246.35 g/mol. Its IUPAC name is pentacyclo[10.7.0.01,4.05,10.013,18]nonadeca-5,7,9,13,15,17-hexaene.
| Compound Name | pentacyclo[10.7.0.01,4.05,10.013,18]nonadeca-5,7,9,13,15,17-hexaene |
|---|---|
| PubChem CID | 123914299 |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | pentacyclo[10.7.0.01,4.05,10.013,18]nonadeca-5,7,9,13,15,17-hexaene |
| SMILES | c1ccc2c(c1)CC1c3ccccc3CC13CCC23 |
| InChI | InChI=1S/C19H18/c1-3-7-15-13(5-1)11-18-16-8-4-2-6-14(16)12-19(18)10-9-17(15)19/h1-8,17-18H,9-12H2 |
| InChIKey | MSAQVTSPSWVWNX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |