C10H9NO — CID 123924841
5-phenyl-2H-1,4-oxazine (PubChem CID 123924841) has the molecular formula C10H9NO and a molecular weight of 159.19 g/mol. Its IUPAC name is 5-phenyl-2H-1,4-oxazine.
| Compound Name | 5-phenyl-2H-1,4-oxazine |
|---|---|
| PubChem CID | 123924841 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 5-phenyl-2H-1,4-oxazine |
| SMILES | C1=NC(c2ccccc2)=COC1 |
| InChI | InChI=1S/C10H9NO/c1-2-4-9(5-3-1)10-8-12-7-6-11-10/h1-6,8H,7H2 |
| InChIKey | GAAUKOFGBQYHTB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |