About 3,7-dimethyl-4-methylsulfanyl-1,2-dihydronaphthalene
3,7-dimethyl-4-methylsulfanyl-1,2-dihydronaphthalene (PubChem CID 123929890) has the molecular formula C13H16S
and a molecular weight of 204.34 g/mol. Its IUPAC name is 3,7-dimethyl-4-methylsulfanyl-1,2-dihydronaphthalene.
Analyze 3,7-dimethyl-4-methylsulfanyl-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-4-methylsulfanyl-1,2-dihydronaphthalene?
The IUPAC name of 3,7-dimethyl-4-methylsulfanyl-1,2-dihydronaphthalene (CID 123929890) is 3,7-dimethyl-4-methylsulfanyl-1,2-dihydronaphthalene.
What is the SMILES notation for 3,7-dimethyl-4-methylsulfanyl-1,2-dihydronaphthalene?
The canonical SMILES for 3,7-dimethyl-4-methylsulfanyl-1,2-dihydronaphthalene is CSC1=C(C)CCc2cc(C)ccc21.
What is the InChIKey of 3,7-dimethyl-4-methylsulfanyl-1,2-dihydronaphthalene?
The InChIKey is AOELFAQTDBGGMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16S/c1-9-4-7-12-11(8-9)6-5-10(2)13(12)14-3/h4,7-8H,5-6H2,1-3H3.
What are the key properties of 3,7-dimethyl-4-methylsulfanyl-1,2-dihydronaphthalene?
3,7-dimethyl-4-methylsulfanyl-1,2-dihydronaphthalene has a molecular weight of 204.34 g/mol, XLogP of 4.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-4-methylsulfanyl-1,2-dihydronaphthalene is sourced from PubChem (CID 123929890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).