C47H58N4+2 — CID 123940597
5-[2-(3,3-diethyl-2-methyl-2H-imidazol-3-ium-1-yl)phenyl]-6,6-diethyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-5H-imidazo[2,1-a]isoquinolin-4-ium (PubChem CID 123940597) has the molecular formula C47H58N4+2 and a molecular weight of 679.01 g/mol. Its IUPAC name is 5-[2-(3,3-diethyl-2-methyl-2H-imidazol-3-ium-1-yl)phenyl]-6,6-diethyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-5H-imidazo[2,1-a]isoquinolin-4-ium.
| Compound Name | 5-[2-(3,3-diethyl-2-methyl-2H-imidazol-3-ium-1-yl)phenyl]-6,6-diethyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-5H-imidazo[2,1-a]isoquinolin-4-ium |
|---|---|
| PubChem CID | 123940597 |
| Molecular Formula | C47H58N4+2 |
| Molecular Weight | 679.01 g/mol |
| Exact Mass | 678.47 |
| IUPAC Name | 5-[2-(3,3-diethyl-2-methyl-2H-imidazol-3-ium-1-yl)phenyl]-6,6-diethyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]-5H-imidazo[2,1-a]isoquinolin-4-ium |
| SMILES | CCC1(CC)c2ccccc2-c2n(-c3c(C(C)C)cc(-c4ccccc4)cc3C(C)C)cc[n+]2C1c1ccccc1N1C=C[N+](CC)(CC)C1C |
| InChI | InChI=1S/C47H58N4/c1-10-47(11-2)42-25-19-17-23-38(42)46-49(44-40(33(5)6)31-37(32-41(44)34(7)8)36-21-15-14-16-22-36)27-28-50(46)45(47)39-24-18-20-26-43(39)48-29-30-51(12-3,13-4)35(48)9/h14-35,45H,10-13H2,1-9H3/q+2 |
| InChIKey | UAJLVQPZXZNFTO-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.01 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|