C21H24O6 — CID 123943733
(2,2-dihydroxy-3,6-diphenoxyhexyl) prop-2-enoate (PubChem CID 123943733) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (2,2-dihydroxy-3,6-diphenoxyhexyl) prop-2-enoate.
| Compound Name | (2,2-dihydroxy-3,6-diphenoxyhexyl) prop-2-enoate |
|---|---|
| PubChem CID | 123943733 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (2,2-dihydroxy-3,6-diphenoxyhexyl) prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)(O)C(CCCOc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C21H24O6/c1-2-20(22)26-16-21(23,24)19(27-18-12-7-4-8-13-18)14-9-15-25-17-10-5-3-6-11-17/h2-8,10-13,19,23-24H,1,9,14-16H2 |
| InChIKey | COXPPWVVZGSIBX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|