C13H22N2 — CID 123954671
5,5,7,7-tetramethylcyclonon-3-ene-1,2-diimine (PubChem CID 123954671) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 5,5,7,7-tetramethylcyclonon-3-ene-1,2-diimine.
| Compound Name | 5,5,7,7-tetramethylcyclonon-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 123954671 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 5,5,7,7-tetramethylcyclonon-3-ene-1,2-diimine |
| SMILES | [H]/N=C1\C=CC(C)(C)CC(C)(C)CC\C1=N/[H] |
| InChI | InChI=1S/C13H22N2/c1-12(2)7-5-10(14)11(15)6-8-13(3,4)9-12/h5,7,14-15H,6,8-9H2,1-4H3/b7-5?,14-10+,15-11+ |
| InChIKey | QEMQHNMLYBJFFW-VNUFLFOLSA-N |
| XLogP | 3.82 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|