C14H21BN2O3 — CID 123983533
6-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydro-1H-pyrrolo[3,4-b]pyrrol-4-one (PubChem CID 123983533) has the molecular formula C14H21BN2O3 and a molecular weight of 276.14 g/mol. Its IUPAC name is 6-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydro-1H-pyrrolo[3,4-b]pyrrol-4-one.
| Compound Name | 6-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydro-1H-pyrrolo[3,4-b]pyrrol-4-one |
|---|---|
| PubChem CID | 123983533 |
| Molecular Formula | C14H21BN2O3 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 6-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,6-dihydro-1H-pyrrolo[3,4-b]pyrrol-4-one |
| SMILES | CCC1NC(=O)c2cc(B3OC(C)(C)C(C)(C)O3)[nH]c21 |
| InChI | InChI=1S/C14H21BN2O3/c1-6-9-11-8(12(18)16-9)7-10(17-11)15-19-13(2,3)14(4,5)20-15/h7,9,17H,6H2,1-5H3,(H,16,18) |
| InChIKey | DIFXVGXYHOKNIF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|