C16H24BNO2 — CID 163856973
6,7-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-1H-indole (PubChem CID 163856973) has the molecular formula C16H24BNO2 and a molecular weight of 273.19 g/mol. Its IUPAC name is 6,7-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-1H-indole.
| Compound Name | 6,7-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-1H-indole |
|---|---|
| PubChem CID | 163856973 |
| Molecular Formula | C16H24BNO2 |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 6,7-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-1H-indole |
| SMILES | CC1C=Cc2cc(B3OC(C)(C)C(C)(C)O3)[nH]c2C1C |
| InChI | InChI=1S/C16H24BNO2/c1-10-7-8-12-9-13(18-14(12)11(10)2)17-19-15(3,4)16(5,6)20-17/h7-11,18H,1-6H3 |
| InChIKey | OZDGOTABVZZMTC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|