C30H28N8O4 — CID 124530006
N-[(R)-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-nitrophenyl]-(benzotriazol-1-yl)methyl]pyridin-2-amine (PubChem CID 124530006) has the molecular formula C30H28N8O4 and a molecular weight of 564.61 g/mol. Its IUPAC name is N-[(R)-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-nitrophenyl]-(benzotriazol-1-yl)methyl]pyridin-2-amine.
| Compound Name | N-[(R)-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-nitrophenyl]-(benzotriazol-1-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 124530006 |
| Molecular Formula | C30H28N8O4 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | N-[(R)-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-3-nitrophenyl]-(benzotriazol-1-yl)methyl]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cc([C@H](Nc2ccccn2)n2nnc3ccccc32)ccc1N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C30H28N8O4/c39-38(40)26-18-22(30(32-29-7-3-4-12-31-29)37-24-6-2-1-5-23(24)33-34-37)9-10-25(26)36-15-13-35(14-16-36)19-21-8-11-27-28(17-21)42-20-41-27/h1-12,17-18,30H,13-16,19-20H2,(H,31,32)/t30-/m1/s1 |
| InChIKey | FODWBRRZSDUVCL-SSEXGKCCSA-N |
| XLogP | 4.44 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|