C14H20INO3S — CID 124628940
(3R)-N-[3-(3-iodophenoxy)propyl]-N-methyl-1,1-dioxothiolan-3-amine (PubChem CID 124628940) has the molecular formula C14H20INO3S and a molecular weight of 409.29 g/mol. Its IUPAC name is (3R)-N-[3-(3-iodophenoxy)propyl]-N-methyl-1,1-dioxothiolan-3-amine.
| Compound Name | (3R)-N-[3-(3-iodophenoxy)propyl]-N-methyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 124628940 |
| Molecular Formula | C14H20INO3S |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | (3R)-N-[3-(3-iodophenoxy)propyl]-N-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CN(CCCOc1cccc(I)c1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H20INO3S/c1-16(13-6-9-20(17,18)11-13)7-3-8-19-14-5-2-4-12(15)10-14/h2,4-5,10,13H,3,6-9,11H2,1H3/t13-/m1/s1 |
| InChIKey | KROFIMUZSOTWEU-CYBMUJFWSA-N |
| XLogP | 2.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|