C6H9Br2N — CID 124708671
(1R,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane (PubChem CID 124708671) has the molecular formula C6H9Br2N and a molecular weight of 254.95 g/mol. Its IUPAC name is (1R,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane.
| Compound Name | (1R,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 124708671 |
| Molecular Formula | C6H9Br2N |
| Molecular Weight | 254.95 g/mol |
| Exact Mass | 252.91 |
| IUPAC Name | (1R,6S)-7,7-dibromo-3-azabicyclo[4.1.0]heptane |
| SMILES | BrC1(Br)[C@H]2CCNC[C@@H]21 |
| InChI | InChI=1S/C6H9Br2N/c7-6(8)4-1-2-9-3-5(4)6/h4-5,9H,1-3H2/t4-,5-/m0/s1 |
| InChIKey | AJNIXRINLKCETA-WHFBIAKZSA-N |
| XLogP | 1.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.95 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|