C18H26N2O2S2 — CID 124759999
5-[(3R)-dithiolan-3-yl]-1-(4-pyridin-4-yloxypiperidin-1-yl)pentan-1-one (PubChem CID 124759999) has the molecular formula C18H26N2O2S2 and a molecular weight of 366.55 g/mol. Its IUPAC name is 5-[(3R)-dithiolan-3-yl]-1-(4-pyridin-4-yloxypiperidin-1-yl)pentan-1-one.
| Compound Name | 5-[(3R)-dithiolan-3-yl]-1-(4-pyridin-4-yloxypiperidin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 124759999 |
| Molecular Formula | C18H26N2O2S2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 5-[(3R)-dithiolan-3-yl]-1-(4-pyridin-4-yloxypiperidin-1-yl)pentan-1-one |
| SMILES | O=C(CCCC[C@@H]1CCSS1)N1CCC(Oc2ccncc2)CC1 |
| InChI | InChI=1S/C18H26N2O2S2/c21-18(4-2-1-3-17-9-14-23-24-17)20-12-7-16(8-13-20)22-15-5-10-19-11-6-15/h5-6,10-11,16-17H,1-4,7-9,12-14H2/t17-/m1/s1 |
| InChIKey | IUIFWPBKZFBZMD-QGZVFWFLSA-N |
| XLogP | 4.17 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|