C17H21Cl2NO2 — CID 125451300
7-(4-chlorobutoxy)-1-(4-chlorobutyl)quinolin-2-one (PubChem CID 125451300) has the molecular formula C17H21Cl2NO2 and a molecular weight of 342.27 g/mol. Its IUPAC name is 7-(4-chlorobutoxy)-1-(4-chlorobutyl)quinolin-2-one.
| Compound Name | 7-(4-chlorobutoxy)-1-(4-chlorobutyl)quinolin-2-one |
|---|---|
| PubChem CID | 125451300 |
| Molecular Formula | C17H21Cl2NO2 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 7-(4-chlorobutoxy)-1-(4-chlorobutyl)quinolin-2-one |
| SMILES | O=c1ccc2ccc(OCCCCCl)cc2n1CCCCCl |
| InChI | InChI=1S/C17H21Cl2NO2/c18-9-1-3-11-20-16-13-15(22-12-4-2-10-19)7-5-14(16)6-8-17(20)21/h5-8,13H,1-4,9-12H2 |
| InChIKey | KKBIONMUIMPJFQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|