C28H38Cl2N4O4 — CID 134425059
[7-[4-[4-[(2Z,4E)-3,4-dichlorohepta-2,4-dien-2-yl]piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 2-aminopropanoate (PubChem CID 134425059) has the molecular formula C28H38Cl2N4O4 and a molecular weight of 565.54 g/mol. Its IUPAC name is [7-[4-[4-[(2Z,4E)-3,4-dichlorohepta-2,4-dien-2-yl]piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 2-aminopropanoate.
| Compound Name | [7-[4-[4-[(2Z,4E)-3,4-dichlorohepta-2,4-dien-2-yl]piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 2-aminopropanoate |
|---|---|
| PubChem CID | 134425059 |
| Molecular Formula | C28H38Cl2N4O4 |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | [7-[4-[4-[(2Z,4E)-3,4-dichlorohepta-2,4-dien-2-yl]piperazin-1-yl]butoxy]-2-oxoquinolin-1-yl]methyl 2-aminopropanoate |
| SMILES | CC/C=C(Cl)\C(Cl)=C(/C)N1CCN(CCCCOc2ccc3ccc(=O)n(COC(=O)C(C)N)c3c2)CC1 |
| InChI | InChI=1S/C28H38Cl2N4O4/c1-4-7-24(29)27(30)21(3)33-15-13-32(14-16-33)12-5-6-17-37-23-10-8-22-9-11-26(35)34(25(22)18-23)19-38-28(36)20(2)31/h7-11,18,20H,4-6,12-17,19,31H2,1-3H3/b24-7+,27-21- |
| InChIKey | OUGAUHHJCWNRIH-CJJRRMKWSA-N |
| XLogP | 4.63 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|