C17H27N3O4 — CID 125496653
tert-butyl 2-[[(1S)-1-[4-[(Z)-(hydroxyhydrazinylidene)methyl]phenyl]-2-methoxyethyl]-methylamino]acetate (PubChem CID 125496653) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl 2-[[(1S)-1-[4-[(Z)-(hydroxyhydrazinylidene)methyl]phenyl]-2-methoxyethyl]-methylamino]acetate.
| Compound Name | tert-butyl 2-[[(1S)-1-[4-[(Z)-(hydroxyhydrazinylidene)methyl]phenyl]-2-methoxyethyl]-methylamino]acetate |
|---|---|
| PubChem CID | 125496653 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | tert-butyl 2-[[(1S)-1-[4-[(Z)-(hydroxyhydrazinylidene)methyl]phenyl]-2-methoxyethyl]-methylamino]acetate |
| SMILES | COC[C@H](c1ccc(/C=N\NO)cc1)N(C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27N3O4/c1-17(2,3)24-16(21)11-20(4)15(12-23-5)14-8-6-13(7-9-14)10-18-19-22/h6-10,15,19,22H,11-12H2,1-5H3/b18-10-/t15-/m1/s1 |
| InChIKey | DWGQIFIZYITNPT-YQYFLZKSSA-N |
| XLogP | 1.96 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|