C11H13NO — CID 12580586
6-methyl-5-phenyl-3,6-dihydro-2H-oxazine (PubChem CID 12580586) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 6-methyl-5-phenyl-3,6-dihydro-2H-oxazine.
| Compound Name | 6-methyl-5-phenyl-3,6-dihydro-2H-oxazine |
|---|---|
| PubChem CID | 12580586 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 6-methyl-5-phenyl-3,6-dihydro-2H-oxazine |
| SMILES | CC1ONCC=C1c1ccccc1 |
| InChI | InChI=1S/C11H13NO/c1-9-11(7-8-12-13-9)10-5-3-2-4-6-10/h2-7,9,12H,8H2,1H3 |
| InChIKey | LDFDYZBTWVVGRU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |