C21H27NO4S — CID 12583733
(3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl 4-methylbenzenesulfonate (PubChem CID 12583733) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 12583733 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (3-tert-butyl-2-phenyl-1,3-oxazolidin-5-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CN(C(C)(C)C)C(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C21H27NO4S/c1-16-10-12-19(13-11-16)27(23,24)25-15-18-14-22(21(2,3)4)20(26-18)17-8-6-5-7-9-17/h5-13,18,20H,14-15H2,1-4H3 |
| InChIKey | JZHHWMMYNFVAAO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|