About [(5S)-3-tert-butyl-1,3-oxazolidin-5-yl]methyl benzenesulfonate;hydrochloride
[(5S)-3-tert-butyl-1,3-oxazolidin-5-yl]methyl benzenesulfonate;hydrochloride (PubChem CID 88827517) has the molecular formula C14H22ClNO4S
and a molecular weight of 335.85 g/mol. Its IUPAC name is [(5S)-3-tert-butyl-1,3-oxazolidin-5-yl]methyl benzenesulfonate;hydrochloride.
Molecular Properties
| Compound Name | [(5S)-3-tert-butyl-1,3-oxazolidin-5-yl]methyl benzenesulfonate;hydrochloride |
| PubChem CID | 88827517 |
| Molecular Formula | C14H22ClNO4S |
| Molecular Weight | 335.85 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | [(5S)-3-tert-butyl-1,3-oxazolidin-5-yl]methyl benzenesulfonate;hydrochloride |
| SMILES | CC(C)(C)N1CO[C@H](COS(=O)(=O)c2ccccc2)C1.Cl |
| InChI | InChI=1S/C14H21NO4S.ClH/c1-14(2,3)15-9-12(18-11-15)10-19-20(16,17)13-7-5-4-6-8-13;/h4-8,12H,9-11H2,1-3H3;1H/t12-;/m0./s1 |
| InChIKey | QAGWEKXTGLXISC-YDALLXLXSA-N |
| XLogP | 2.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.85 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(5S)-3-tert-butyl-1,3-oxazolidin-5-yl]methyl benzenesulfonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-3-tert-butyl-1,3-oxazolidin-5-yl]methyl benzenesulfonate;hydrochloride?
The IUPAC name of [(5S)-3-tert-butyl-1,3-oxazolidin-5-yl]methyl benzenesulfonate;hydrochloride (CID 88827517) is [(5S)-3-tert-butyl-1,3-oxazolidin-5-yl]methyl benzenesulfonate;hydrochloride.
What is the SMILES notation for [(5S)-3-tert-butyl-1,3-oxazolidin-5-yl]methyl benzenesulfonate;hydrochloride?
The canonical SMILES for [(5S)-3-tert-butyl-1,3-oxazolidin-5-yl]methyl benzenesulfonate;hydrochloride is CC(C)(C)N1CO[C@H](COS(=O)(=O)c2ccccc2)C1.Cl.
What is the InChIKey of [(5S)-3-tert-butyl-1,3-oxazolidin-5-yl]methyl benzenesulfonate;hydrochloride?
The InChIKey is QAGWEKXTGLXISC-YDALLXLXSA-N. The full InChI is InChI=1S/C14H21NO4S.ClH/c1-14(2,3)15-9-12(18-11-15)10-19-20(16,17)13-7-5-4-6-8-13;/h4-8,12H,9-11H2,1-3H3;1H/t12-;/m0./s1.
What are the key properties of [(5S)-3-tert-butyl-1,3-oxazolidin-5-yl]methyl benzenesulfonate;hydrochloride?
[(5S)-3-tert-butyl-1,3-oxazolidin-5-yl]methyl benzenesulfonate;hydrochloride has a molecular weight of 335.85 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-3-tert-butyl-1,3-oxazolidin-5-yl]methyl benzenesulfonate;hydrochloride is sourced from PubChem (CID 88827517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).