C23H30O11S2 — CID 90926082
[(4S,7S)-7-(benzenesulfonyloxymethyl)-6-(ethoxymethoxy)-5-methoxy-1,3-dioxepan-4-yl]methyl benzenesulfonate (PubChem CID 90926082) has the molecular formula C23H30O11S2 and a molecular weight of 546.62 g/mol. Its IUPAC name is [(4S,7S)-7-(benzenesulfonyloxymethyl)-6-(ethoxymethoxy)-5-methoxy-1,3-dioxepan-4-yl]methyl benzenesulfonate.
| Compound Name | [(4S,7S)-7-(benzenesulfonyloxymethyl)-6-(ethoxymethoxy)-5-methoxy-1,3-dioxepan-4-yl]methyl benzenesulfonate |
|---|---|
| PubChem CID | 90926082 |
| Molecular Formula | C23H30O11S2 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | [(4S,7S)-7-(benzenesulfonyloxymethyl)-6-(ethoxymethoxy)-5-methoxy-1,3-dioxepan-4-yl]methyl benzenesulfonate |
| SMILES | CCOCOC1C(OC)[C@H](COS(=O)(=O)c2ccccc2)OCO[C@H]1COS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H30O11S2/c1-3-29-16-32-23-21(15-34-36(26,27)19-12-8-5-9-13-19)31-17-30-20(22(23)28-2)14-33-35(24,25)18-10-6-4-7-11-18/h4-13,20-23H,3,14-17H2,1-2H3/t20-,21-,22?,23?/m0/s1 |
| InChIKey | CGGLEBIMXOTPAX-SIYKVTCMSA-N |
| XLogP | 1.93 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|