C21H14Cl2N2O5 — CID 126044495
[2-[(E)-3-[2-(furan-2-carbonyl)hydrazinyl]-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 126044495) has the molecular formula C21H14Cl2N2O5 and a molecular weight of 445.26 g/mol. Its IUPAC name is [2-[(E)-3-[2-(furan-2-carbonyl)hydrazinyl]-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-[(E)-3-[2-(furan-2-carbonyl)hydrazinyl]-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 126044495 |
| Molecular Formula | C21H14Cl2N2O5 |
| Molecular Weight | 445.26 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | [2-[(E)-3-[2-(furan-2-carbonyl)hydrazinyl]-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C(/C=C/c1ccccc1OC(=O)c1ccc(Cl)cc1Cl)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C21H14Cl2N2O5/c22-14-8-9-15(16(23)12-14)21(28)30-17-5-2-1-4-13(17)7-10-19(26)24-25-20(27)18-6-3-11-29-18/h1-12H,(H,24,26)(H,25,27)/b10-7+ |
| InChIKey | ZLADIPSSPCBRDZ-JXMROGBWSA-N |
| XLogP | 4.28 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|