C23H13F3N2O6 — CID 126186969
(2-nitrophenyl)methyl 1,3-dioxo-2-[2-(trifluoromethyl)phenyl]isoindole-5-carboxylate (PubChem CID 126186969) has the molecular formula C23H13F3N2O6 and a molecular weight of 470.36 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 1,3-dioxo-2-[2-(trifluoromethyl)phenyl]isoindole-5-carboxylate.
| Compound Name | (2-nitrophenyl)methyl 1,3-dioxo-2-[2-(trifluoromethyl)phenyl]isoindole-5-carboxylate |
|---|---|
| PubChem CID | 126186969 |
| Molecular Formula | C23H13F3N2O6 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | (2-nitrophenyl)methyl 1,3-dioxo-2-[2-(trifluoromethyl)phenyl]isoindole-5-carboxylate |
| SMILES | O=C(OCc1ccccc1[N+](=O)[O-])c1ccc2c(c1)C(=O)N(c1ccccc1C(F)(F)F)C2=O |
| InChI | InChI=1S/C23H13F3N2O6/c24-23(25,26)17-6-2-4-8-19(17)27-20(29)15-10-9-13(11-16(15)21(27)30)22(31)34-12-14-5-1-3-7-18(14)28(32)33/h1-11H,12H2 |
| InChIKey | YVNHDCRNXKBHPD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|