C27H23N5O9 — CID 126227257
2-[(4E)-4-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 126227257) has the molecular formula C27H23N5O9 and a molecular weight of 561.51 g/mol. Its IUPAC name is 2-[(4E)-4-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126227257 |
| Molecular Formula | C27H23N5O9 |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 2-[(4E)-4-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(OC)c2)C1=O |
| InChI | InChI=1S/C27H23N5O9/c1-3-17-6-4-5-7-19(17)28-25(33)15-30-26(34)20(29-27(30)35)12-16-8-10-23(24(13-16)40-2)41-22-11-9-18(31(36)37)14-21(22)32(38)39/h4-14H,3,15H2,1-2H3,(H,28,33)(H,29,35)/b20-12+ |
| InChIKey | KFEDLLVPWFBZSF-UDWIEESQSA-N |
| XLogP | 4.40 |
| TPSA | 183.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|