C30H23BrF3N5O4 — CID 126298654
6-bromo-3-[[2,5-dimethyl-1-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]pyrrol-3-yl]methylideneamino]-2-ethylquinazolin-4-one (PubChem CID 126298654) has the molecular formula C30H23BrF3N5O4 and a molecular weight of 654.44 g/mol. Its IUPAC name is 6-bromo-3-[[2,5-dimethyl-1-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]pyrrol-3-yl]methylideneamino]-2-ethylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[2,5-dimethyl-1-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]pyrrol-3-yl]methylideneamino]-2-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 126298654 |
| Molecular Formula | C30H23BrF3N5O4 |
| Molecular Weight | 654.44 g/mol |
| Exact Mass | 653.09 |
| IUPAC Name | 6-bromo-3-[[2,5-dimethyl-1-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]pyrrol-3-yl]methylideneamino]-2-ethylquinazolin-4-one |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(C)n(-c2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C30H23BrF3N5O4/c1-4-28-36-25-11-6-21(31)15-24(25)29(40)38(28)35-16-19-13-17(2)37(18(19)3)22-7-9-23(10-8-22)43-27-12-5-20(30(32,33)34)14-26(27)39(41)42/h5-16H,4H2,1-3H3 |
| InChIKey | UIRGLHSAYMXQFA-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 104.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.44 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|