C13H14N2O6S2 — CID 12630372
butan-2-yl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate (PubChem CID 12630372) has the molecular formula C13H14N2O6S2 and a molecular weight of 358.40 g/mol. Its IUPAC name is butan-2-yl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate.
| Compound Name | butan-2-yl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate |
|---|---|
| PubChem CID | 12630372 |
| Molecular Formula | C13H14N2O6S2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | butan-2-yl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfonyl]acetate |
| SMILES | CCC(C)OC(=O)CS(=O)(=O)c1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C13H14N2O6S2/c1-3-8(2)21-12(16)7-23(19,20)13-14-10-5-4-9(15(17)18)6-11(10)22-13/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | IYRBZVGFMQLOSR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 116.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|