C31H22N4O3 — CID 126407705
3-[[1-(1,3-benzodioxol-5-ylmethyl)indol-3-yl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126407705) has the molecular formula C31H22N4O3 and a molecular weight of 498.54 g/mol. Its IUPAC name is 3-[[1-(1,3-benzodioxol-5-ylmethyl)indol-3-yl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[1-(1,3-benzodioxol-5-ylmethyl)indol-3-yl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126407705 |
| Molecular Formula | C31H22N4O3 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 3-[[1-(1,3-benzodioxol-5-ylmethyl)indol-3-yl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2ccccc2)n1N=Cc1cn(Cc2ccc3c(c2)OCO3)c2ccccc12 |
| InChI | InChI=1S/C31H22N4O3/c36-31-25-11-4-6-12-26(25)33-30(22-8-2-1-3-9-22)35(31)32-17-23-19-34(27-13-7-5-10-24(23)27)18-21-14-15-28-29(16-21)38-20-37-28/h1-17,19H,18,20H2 |
| InChIKey | LANUGXSGYPDFHL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 70.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|