C36H32FN5O4 — CID 126409692
5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-[2-(4-fluoroanilino)-2-oxoethyl]-2-methylindol-3-yl]methylideneamino]furan-2-carboxamide (PubChem CID 126409692) has the molecular formula C36H32FN5O4 and a molecular weight of 617.68 g/mol. Its IUPAC name is 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-[2-(4-fluoroanilino)-2-oxoethyl]-2-methylindol-3-yl]methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-[2-(4-fluoroanilino)-2-oxoethyl]-2-methylindol-3-yl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 126409692 |
| Molecular Formula | C36H32FN5O4 |
| Molecular Weight | 617.68 g/mol |
| Exact Mass | 617.24 |
| IUPAC Name | 5-[[4-(2,5-dimethylpyrrol-1-yl)phenoxy]methyl]-N-[(E)-[1-[2-(4-fluoroanilino)-2-oxoethyl]-2-methylindol-3-yl]methylideneamino]furan-2-carboxamide |
| SMILES | Cc1ccc(C)n1-c1ccc(OCc2ccc(C(=O)N/N=C/c3c(C)n(CC(=O)Nc4ccc(F)cc4)c4ccccc34)o2)cc1 |
| InChI | InChI=1S/C36H32FN5O4/c1-23-8-9-24(2)42(23)28-14-16-29(17-15-28)45-22-30-18-19-34(46-30)36(44)40-38-20-32-25(3)41(33-7-5-4-6-31(32)33)21-35(43)39-27-12-10-26(37)11-13-27/h4-20H,21-22H2,1-3H3,(H,39,43)(H,40,44)/b38-20+ |
| InChIKey | SJONHBTXERSLNM-CHSHITCJSA-N |
| XLogP | 7.07 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.68 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|