C9H18N6S — CID 12650183
4-[amino(methyl)amino]-N-butan-2-yl-6-methylsulfanyl-1,3,5-triazin-2-amine (PubChem CID 12650183) has the molecular formula C9H18N6S and a molecular weight of 242.35 g/mol. Its IUPAC name is 4-[amino(methyl)amino]-N-butan-2-yl-6-methylsulfanyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[amino(methyl)amino]-N-butan-2-yl-6-methylsulfanyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 12650183 |
| Molecular Formula | C9H18N6S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 4-[amino(methyl)amino]-N-butan-2-yl-6-methylsulfanyl-1,3,5-triazin-2-amine |
| SMILES | CCC(C)Nc1nc(SC)nc(N(C)N)n1 |
| InChI | InChI=1S/C9H18N6S/c1-5-6(2)11-7-12-8(15(3)10)14-9(13-7)16-4/h6H,5,10H2,1-4H3,(H,11,12,13,14) |
| InChIKey | PEAHIPVCWQOBBP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|