C12H18N6O2S — CID 912172
methyl (2S)-2-[cyano-[4-methylsulfanyl-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]propanoate (PubChem CID 912172) has the molecular formula C12H18N6O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is methyl (2S)-2-[cyano-[4-methylsulfanyl-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]propanoate.
| Compound Name | methyl (2S)-2-[cyano-[4-methylsulfanyl-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 912172 |
| Molecular Formula | C12H18N6O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | methyl (2S)-2-[cyano-[4-methylsulfanyl-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)N(C#N)c1nc(NC(C)C)nc(SC)n1 |
| InChI | InChI=1S/C12H18N6O2S/c1-7(2)14-10-15-11(17-12(16-10)21-5)18(6-13)8(3)9(19)20-4/h7-8H,1-5H3,(H,14,15,16,17)/t8-/m0/s1 |
| InChIKey | OFZDJFWKHJTJJJ-QMMMGPOBSA-N |
| XLogP | 1.26 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|