C9H12N6O2S — CID 742236
methyl 2-[cyano-[4-(methylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]acetate (PubChem CID 742236) has the molecular formula C9H12N6O2S and a molecular weight of 268.30 g/mol. Its IUPAC name is methyl 2-[cyano-[4-(methylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]acetate.
| Compound Name | methyl 2-[cyano-[4-(methylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]acetate |
|---|---|
| PubChem CID | 742236 |
| Molecular Formula | C9H12N6O2S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | methyl 2-[cyano-[4-(methylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]acetate |
| SMILES | CNc1nc(SC)nc(N(C#N)CC(=O)OC)n1 |
| InChI | InChI=1S/C9H12N6O2S/c1-11-7-12-8(14-9(13-7)18-3)15(5-10)4-6(16)17-2/h4H2,1-3H3,(H,11,12,13,14) |
| InChIKey | NLLODRWSQHSMCM-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|