C13H21N7OS — CID 27195368
(2S)-2-[cyano-[4-(methylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]-N,N-diethylpropanamide (PubChem CID 27195368) has the molecular formula C13H21N7OS and a molecular weight of 323.43 g/mol. Its IUPAC name is (2S)-2-[cyano-[4-(methylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]-N,N-diethylpropanamide.
| Compound Name | (2S)-2-[cyano-[4-(methylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 27195368 |
| Molecular Formula | C13H21N7OS |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (2S)-2-[cyano-[4-(methylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)[C@H](C)N(C#N)c1nc(NC)nc(SC)n1 |
| InChI | InChI=1S/C13H21N7OS/c1-6-19(7-2)10(21)9(3)20(8-14)12-16-11(15-4)17-13(18-12)22-5/h9H,6-7H2,1-5H3,(H,15,16,17,18)/t9-/m0/s1 |
| InChIKey | KLTHDOTVLABRJE-VIFPVBQESA-N |
| XLogP | 1.18 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|