C10H10F6O7S — CID 126549837
3,3,3-trifluoro-2-[2-(2-oxobut-3-enoxy)acetyl]oxy-2-(trifluoromethyl)propane-1-sulfonic acid (PubChem CID 126549837) has the molecular formula C10H10F6O7S and a molecular weight of 388.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[2-(2-oxobut-3-enoxy)acetyl]oxy-2-(trifluoromethyl)propane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-[2-(2-oxobut-3-enoxy)acetyl]oxy-2-(trifluoromethyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 126549837 |
| Molecular Formula | C10H10F6O7S |
| Molecular Weight | 388.24 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 3,3,3-trifluoro-2-[2-(2-oxobut-3-enoxy)acetyl]oxy-2-(trifluoromethyl)propane-1-sulfonic acid |
| SMILES | C=CC(=O)COCC(=O)OC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F6O7S/c1-2-6(17)3-22-4-7(18)23-8(9(11,12)13,10(14,15)16)5-24(19,20)21/h2H,1,3-5H2,(H,19,20,21) |
| InChIKey | NYBOHVSFRJCWCJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|