C14H17N3O3 — CID 12656267
4-[(4,6-diamino-3-pyridinyl)methyl]-2,6-dimethoxyphenol (PubChem CID 12656267) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-[(4,6-diamino-3-pyridinyl)methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(4,6-diamino-3-pyridinyl)methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 12656267 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-[(4,6-diamino-3-pyridinyl)methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(Cc2cnc(N)cc2N)cc(OC)c1O |
| InChI | InChI=1S/C14H17N3O3/c1-19-11-4-8(5-12(20-2)14(11)18)3-9-7-17-13(16)6-10(9)15/h4-7,18H,3H2,1-2H3,(H4,15,16,17) |
| InChIKey | KJACNYSLBZOBLT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |