About 4-[[2-amino-4-(benzylideneamino)pyrimidin-5-yl]methyl]-2,6-dimethoxyphenol
4-[[2-amino-4-(benzylideneamino)pyrimidin-5-yl]methyl]-2,6-dimethoxyphenol (PubChem CID 134148134) has the molecular formula C20H20N4O3
and a molecular weight of 364.41 g/mol. Its IUPAC name is 4-[[2-amino-4-(benzylideneamino)pyrimidin-5-yl]methyl]-2,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-[[2-amino-4-(benzylideneamino)pyrimidin-5-yl]methyl]-2,6-dimethoxyphenol |
| PubChem CID | 134148134 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-[[2-amino-4-(benzylideneamino)pyrimidin-5-yl]methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(Cc2cnc(N)nc2/N=C/c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C20H20N4O3/c1-26-16-9-14(10-17(27-2)18(16)25)8-15-12-23-20(21)24-19(15)22-11-13-6-4-3-5-7-13/h3-7,9-12,25H,8H2,1-2H3,(H2,21,23,24)/b22-11+ |
| InChIKey | IKQHVKUYZPELON-SSDVNMTOSA-N |
| XLogP | 3.12 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[[2-amino-4-(benzylideneamino)pyrimidin-5-yl]methyl]-2,6-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-amino-4-(benzylideneamino)pyrimidin-5-yl]methyl]-2,6-dimethoxyphenol?
The IUPAC name of 4-[[2-amino-4-(benzylideneamino)pyrimidin-5-yl]methyl]-2,6-dimethoxyphenol (CID 134148134) is 4-[[2-amino-4-(benzylideneamino)pyrimidin-5-yl]methyl]-2,6-dimethoxyphenol.
What is the SMILES notation for 4-[[2-amino-4-(benzylideneamino)pyrimidin-5-yl]methyl]-2,6-dimethoxyphenol?
The canonical SMILES for 4-[[2-amino-4-(benzylideneamino)pyrimidin-5-yl]methyl]-2,6-dimethoxyphenol is COc1cc(Cc2cnc(N)nc2/N=C/c2ccccc2)cc(OC)c1O.
What is the InChIKey of 4-[[2-amino-4-(benzylideneamino)pyrimidin-5-yl]methyl]-2,6-dimethoxyphenol?
The InChIKey is IKQHVKUYZPELON-SSDVNMTOSA-N. The full InChI is InChI=1S/C20H20N4O3/c1-26-16-9-14(10-17(27-2)18(16)25)8-15-12-23-20(21)24-19(15)22-11-13-6-4-3-5-7-13/h3-7,9-12,25H,8H2,1-2H3,(H2,21,23,24)/b22-11+.
What are the key properties of 4-[[2-amino-4-(benzylideneamino)pyrimidin-5-yl]methyl]-2,6-dimethoxyphenol?
4-[[2-amino-4-(benzylideneamino)pyrimidin-5-yl]methyl]-2,6-dimethoxyphenol has a molecular weight of 364.41 g/mol, XLogP of 3.12, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-amino-4-(benzylideneamino)pyrimidin-5-yl]methyl]-2,6-dimethoxyphenol is sourced from PubChem (CID 134148134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).