C20H27N5O3 — CID 126583414
2-[3-[[cyclopropyl(morpholine-2-carboximidoyl)amino]methyl]indol-1-yl]-N-methoxyacetamide (PubChem CID 126583414) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-[3-[[cyclopropyl(morpholine-2-carboximidoyl)amino]methyl]indol-1-yl]-N-methoxyacetamide.
| Compound Name | 2-[3-[[cyclopropyl(morpholine-2-carboximidoyl)amino]methyl]indol-1-yl]-N-methoxyacetamide |
|---|---|
| PubChem CID | 126583414 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 2-[3-[[cyclopropyl(morpholine-2-carboximidoyl)amino]methyl]indol-1-yl]-N-methoxyacetamide |
| SMILES | [H]/N=C(\C1CNCCO1)N(Cc1cn(CC(=O)NOC)c2ccccc12)C1CC1 |
| InChI | InChI=1S/C20H27N5O3/c1-27-23-19(26)13-24-11-14(16-4-2-3-5-17(16)24)12-25(15-6-7-15)20(21)18-10-22-8-9-28-18/h2-5,11,15,18,21-22H,6-10,12-13H2,1H3,(H,23,26)/b21-20+ |
| InChIKey | XORJMWYSCQNDDP-QZQOTICOSA-N |
| XLogP | 1.25 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|