C14H21NO2 — CID 126602772
N-hydroxy-3,5-dimethyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxamide (PubChem CID 126602772) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is N-hydroxy-3,5-dimethyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxamide.
| Compound Name | N-hydroxy-3,5-dimethyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxamide |
|---|---|
| PubChem CID | 126602772 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-hydroxy-3,5-dimethyltetracyclo[5.3.1.03,9.05,9]undecane-1-carboxamide |
| SMILES | CC12CC3CC4(C(=O)NO)CC(C)(C1)C2(C3)C4 |
| InChI | InChI=1S/C14H21NO2/c1-11-3-9-4-13(10(16)15-17)7-12(2,6-11)14(11,5-9)8-13/h9,17H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | DGKNKKPMXNLMBN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|