C36H22O16 — CID 126611909
2-[2,6-dicarboxy-4-[2-(3,5-dicarboxyphenyl)ethynyl]phenyl]-5-[2-(3,5-dicarboxyphenyl)ethyl]benzene-1,3-dicarboxylic acid (PubChem CID 126611909) has the molecular formula C36H22O16 and a molecular weight of 710.56 g/mol. Its IUPAC name is 2-[2,6-dicarboxy-4-[2-(3,5-dicarboxyphenyl)ethynyl]phenyl]-5-[2-(3,5-dicarboxyphenyl)ethyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 2-[2,6-dicarboxy-4-[2-(3,5-dicarboxyphenyl)ethynyl]phenyl]-5-[2-(3,5-dicarboxyphenyl)ethyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 126611909 |
| Molecular Formula | C36H22O16 |
| Molecular Weight | 710.56 g/mol |
| Exact Mass | 710.09 |
| IUPAC Name | 2-[2,6-dicarboxy-4-[2-(3,5-dicarboxyphenyl)ethynyl]phenyl]-5-[2-(3,5-dicarboxyphenyl)ethyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C#Cc2cc(C(=O)O)c(-c3c(C(=O)O)cc(CCc4cc(C(=O)O)cc(C(=O)O)c4)cc3C(=O)O)c(C(=O)O)c2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C36H22O16/c37-29(38)19-5-15(6-20(13-19)30(39)40)1-3-17-9-23(33(45)46)27(24(10-17)34(47)48)28-25(35(49)50)11-18(12-26(28)36(51)52)4-2-16-7-21(31(41)42)14-22(8-16)32(43)44/h5-14H,1,3H2,(H,37,38)(H,39,40)(H,41,42)(H,43,44)(H,45,46)(H,47,48)(H,49,50)(H,51,52) |
| InChIKey | FVMYLSMLMNPFFX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 298.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|