C13H19ClN6 — CID 12661885
4-chloro-N-(5-hexyl-1H-1,2,4-triazol-3-yl)-6-methylpyrimidin-2-amine (PubChem CID 12661885) has the molecular formula C13H19ClN6 and a molecular weight of 294.79 g/mol. Its IUPAC name is 4-chloro-N-(5-hexyl-1H-1,2,4-triazol-3-yl)-6-methylpyrimidin-2-amine.
| Compound Name | 4-chloro-N-(5-hexyl-1H-1,2,4-triazol-3-yl)-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 12661885 |
| Molecular Formula | C13H19ClN6 |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-chloro-N-(5-hexyl-1H-1,2,4-triazol-3-yl)-6-methylpyrimidin-2-amine |
| SMILES | CCCCCCc1nc(Nc2nc(C)cc(Cl)n2)n[nH]1 |
| InChI | InChI=1S/C13H19ClN6/c1-3-4-5-6-7-11-17-13(20-19-11)18-12-15-9(2)8-10(14)16-12/h8H,3-7H2,1-2H3,(H2,15,16,17,18,19,20) |
| InChIKey | BHRNTUMYUHRNCE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|