C25H31N5O3S — CID 126695091
methyl 3-phenyl-3-[4-[7-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propanoate (PubChem CID 126695091) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is methyl 3-phenyl-3-[4-[7-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propanoate.
| Compound Name | methyl 3-phenyl-3-[4-[7-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propanoate |
|---|---|
| PubChem CID | 126695091 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | methyl 3-phenyl-3-[4-[7-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]propanoate |
| SMILES | COC(=O)CC(c1ccccc1)n1cc(-c2ncnc3c2ccn3COCCS(C)(C)C)cn1 |
| InChI | InChI=1S/C25H31N5O3S/c1-32-23(31)14-22(19-8-6-5-7-9-19)30-16-20(15-28-30)24-21-10-11-29(25(21)27-17-26-24)18-33-12-13-34(2,3)4/h5-11,15-17,22H,12-14,18H2,1-4H3 |
| InChIKey | CXILPLMFRLOGAM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|